| Cas No.: | 1903742-34-6 |
| Chemical Name: | Complement factor D-IN-2 |
| SMILES: | O=C([C@H]1N(C(CN2N=C(C(C)=O)C3=C2C=CC(C4=CN=C(C)N=C4)=C3)=O)[C@]5([H])C[C@]5([H])C1)NC6=NC(Br)=CC=C6 |
| Formula: | C27H24BrN7O3 |
| M.Wt: | 574.43 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
